C23H40O3 — CID 59987688
(2S,3S)-3-(methoxymethoxy)-1-[(1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-ol (PubChem CID 59987688) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is (2S,3S)-3-(methoxymethoxy)-1-[(1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-ol.
| Compound Name | (2S,3S)-3-(methoxymethoxy)-1-[(1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 59987688 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | (2S,3S)-3-(methoxymethoxy)-1-[(1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-ol |
| SMILES | C=CCC(C)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1C[C@H](O)[C@H](C=C)OCOC |
| InChI | InChI=1S/C23H40O3/c1-8-10-17(5)13-20-18(6)11-12-19(16(3)4)21(20)14-22(24)23(9-2)26-15-25-7/h8-9,11,16-17,19-24H,1-2,10,12-15H2,3-7H3/t17?,19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | LPONULVMNZTWCL-UTECOTHKSA-N |
| XLogP | 5.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|