About 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid
4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 59987931) has the molecular formula C16H10O5S
and a molecular weight of 314.32 g/mol. Its IUPAC name is 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid |
| PubChem CID | 59987931 |
| Molecular Formula | C16H10O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1CC(=O)/C(=C/c2ccc(-c3ccc(C(=O)O)cc3)o2)S1 |
| InChI | InChI=1S/C16H10O5S/c17-12-8-15(18)22-14(12)7-11-5-6-13(21-11)9-1-3-10(4-2-9)16(19)20/h1-7H,8H2,(H,19,20)/b14-7- |
| InChIKey | YTKJUFPDRLDLQR-AUWJEWJLSA-N |
| XLogP | 3.22 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid?
The IUPAC name of 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid (CID 59987931) is 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid?
The canonical SMILES for 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid is O=C1CC(=O)/C(=C/c2ccc(-c3ccc(C(=O)O)cc3)o2)S1.
What is the InChIKey of 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid?
The InChIKey is YTKJUFPDRLDLQR-AUWJEWJLSA-N. The full InChI is InChI=1S/C16H10O5S/c17-12-8-15(18)22-14(12)7-11-5-6-13(21-11)9-1-3-10(4-2-9)16(19)20/h1-7H,8H2,(H,19,20)/b14-7-.
What are the key properties of 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid?
4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid has a molecular weight of 314.32 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(Z)-(3,5-dioxothiolan-2-ylidene)methyl]furan-2-yl]benzoic acid is sourced from PubChem (CID 59987931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).