C21H19FN2O4 — CID 59988433
methyl 1-(2-acetyloxyethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrrole-2-carboxylate (PubChem CID 59988433) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl 1-(2-acetyloxyethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrrole-2-carboxylate.
| Compound Name | methyl 1-(2-acetyloxyethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 59988433 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | methyl 1-(2-acetyloxyethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)c(-c2ccncc2)cn1CCOC(C)=O |
| InChI | InChI=1S/C21H19FN2O4/c1-14(25)28-12-11-24-13-18(15-7-9-23-10-8-15)19(20(24)21(26)27-2)16-3-5-17(22)6-4-16/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | GIUFTUZEDSTHOQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |