C26H26FN3O3 — CID 59988440
methyl 4-(4-fluorophenyl)-1-methyl-5-(4-morpholin-4-ylbut-1-ynyl)-3-pyridin-4-ylpyrrole-2-carboxylate (PubChem CID 59988440) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-1-methyl-5-(4-morpholin-4-ylbut-1-ynyl)-3-pyridin-4-ylpyrrole-2-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-1-methyl-5-(4-morpholin-4-ylbut-1-ynyl)-3-pyridin-4-ylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 59988440 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-1-methyl-5-(4-morpholin-4-ylbut-1-ynyl)-3-pyridin-4-ylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(-c2ccncc2)c(-c2ccc(F)cc2)c(C#CCCN2CCOCC2)n1C |
| InChI | InChI=1S/C26H26FN3O3/c1-29-22(5-3-4-14-30-15-17-33-18-16-30)23(19-6-8-21(27)9-7-19)24(25(29)26(31)32-2)20-10-12-28-13-11-20/h6-13H,4,14-18H2,1-2H3 |
| InChIKey | PPKJRXFLNGDBSU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|