C28H29ClN4O4S — CID 59988733
ethyl 3-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-1,2-oxazol-5-yl]butanoate (PubChem CID 59988733) has the molecular formula C28H29ClN4O4S and a molecular weight of 553.08 g/mol. Its IUPAC name is ethyl 3-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-1,2-oxazol-5-yl]butanoate.
| Compound Name | ethyl 3-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-1,2-oxazol-5-yl]butanoate |
|---|---|
| PubChem CID | 59988733 |
| Molecular Formula | C28H29ClN4O4S |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | ethyl 3-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-1,2-oxazol-5-yl]butanoate |
| SMILES | CCOC(=O)CC(Cc1cc(OCCc2ccc3c(n2)NCCC3)no1)c1cnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C28H29ClN4O4S/c1-2-35-26(34)15-20(24-17-31-28(38-24)19-5-8-21(29)9-6-19)14-23-16-25(33-37-23)36-13-11-22-10-7-18-4-3-12-30-27(18)32-22/h5-10,16-17,20H,2-4,11-15H2,1H3,(H,30,32) |
| InChIKey | RFRKMSRYSDUTNC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |