About 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine
5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine (PubChem CID 59989230) has the molecular formula C23H21N3O2
and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine |
| PubChem CID | 59989230 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine |
| SMILES | COc1ccc(-c2ccc(-c3cc(Nc4ccccc4)n[nH]3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H21N3O2/c1-27-19-12-13-20(22(14-19)28-2)16-8-10-17(11-9-16)21-15-23(26-25-21)24-18-6-4-3-5-7-18/h3-15H,1-2H3,(H2,24,25,26) |
| InChIKey | TZCPYMJCGLLGLT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine?
The IUPAC name of 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine (CID 59989230) is 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine.
What is the SMILES notation for 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine?
The canonical SMILES for 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine is COc1ccc(-c2ccc(-c3cc(Nc4ccccc4)n[nH]3)cc2)c(OC)c1.
What is the InChIKey of 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine?
The InChIKey is TZCPYMJCGLLGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O2/c1-27-19-12-13-20(22(14-19)28-2)16-8-10-17(11-9-16)21-15-23(26-25-21)24-18-6-4-3-5-7-18/h3-15H,1-2H3,(H2,24,25,26).
What are the key properties of 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine?
5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine has a molecular weight of 371.44 g/mol, XLogP of 5.50, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2,4-dimethoxyphenyl)phenyl]-N-phenyl-1H-pyrazol-3-amine is sourced from PubChem (CID 59989230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).