C17H30N4O12P2 — CID 59989358
[[[(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 7-(methylamino)heptanoate (PubChem CID 59989358) has the molecular formula C17H30N4O12P2 and a molecular weight of 544.39 g/mol. Its IUPAC name is [[[(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 7-(methylamino)heptanoate.
| Compound Name | [[[(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 7-(methylamino)heptanoate |
|---|---|
| PubChem CID | 59989358 |
| Molecular Formula | C17H30N4O12P2 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | [[[(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 7-(methylamino)heptanoate |
| SMILES | CNCCCCCCC(=O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H](O)C1O |
| InChI | InChI=1S/C17H30N4O12P2/c1-19-8-5-3-2-4-6-13(22)32-35(28,29)33-34(26,27)30-10-11-14(23)15(24)16(31-11)21-9-7-12(18)20-17(21)25/h7,9,11,14-16,19,23-24H,2-6,8,10H2,1H3,(H,26,27)(H,28,29)(H2,18,20,25)/t11-,14?,15+,16-/m1/s1 |
| InChIKey | HPOHWVLDEYVOKO-IGJNJABESA-N |
| XLogP | -0.61 |
| TPSA | 241.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|