C18H25F3N2O3S — CID 59989393
1-(1-methylpiperidin-4-yl)sulfonyl-4-[4-(trifluoromethyl)phenoxy]piperidine (PubChem CID 59989393) has the molecular formula C18H25F3N2O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)sulfonyl-4-[4-(trifluoromethyl)phenoxy]piperidine.
| Compound Name | 1-(1-methylpiperidin-4-yl)sulfonyl-4-[4-(trifluoromethyl)phenoxy]piperidine |
|---|---|
| PubChem CID | 59989393 |
| Molecular Formula | C18H25F3N2O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)sulfonyl-4-[4-(trifluoromethyl)phenoxy]piperidine |
| SMILES | CN1CCC(S(=O)(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C18H25F3N2O3S/c1-22-10-8-17(9-11-22)27(24,25)23-12-6-16(7-13-23)26-15-4-2-14(3-5-15)18(19,20)21/h2-5,16-17H,6-13H2,1H3 |
| InChIKey | INIVXVUZZCHKLT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |