About methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate
methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 599894) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| PubChem CID | 599894 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)C1(C)N=C(c2ccccc2)OC1C |
| InChI | InChI=1S/C13H15NO3/c1-9-13(2,12(15)16-3)14-11(17-9)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | JBPYDTYRFMIWII-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (CID 599894) is methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate is COC(=O)C1(C)N=C(c2ccccc2)OC1C.
What is the InChIKey of methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The InChIKey is JBPYDTYRFMIWII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9-13(2,12(15)16-3)14-11(17-9)10-7-5-4-6-8-10/h4-9H,1-3H3.
What are the key properties of methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,5-dimethyl-2-phenyl-5H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 599894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).