C42H50N2 — CID 59989781
4-[1-[4-(dipropylamino)phenyl]-6,6-diphenylhexa-1,3,5-trienyl]-N,N-dipropylaniline (PubChem CID 59989781) has the molecular formula C42H50N2 and a molecular weight of 582.88 g/mol. Its IUPAC name is 4-[1-[4-(dipropylamino)phenyl]-6,6-diphenylhexa-1,3,5-trienyl]-N,N-dipropylaniline.
| Compound Name | 4-[1-[4-(dipropylamino)phenyl]-6,6-diphenylhexa-1,3,5-trienyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 59989781 |
| Molecular Formula | C42H50N2 |
| Molecular Weight | 582.88 g/mol |
| Exact Mass | 582.40 |
| IUPAC Name | 4-[1-[4-(dipropylamino)phenyl]-6,6-diphenylhexa-1,3,5-trienyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(C(=CC=CC=C(c2ccccc2)c2ccccc2)c2ccc(N(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C42H50N2/c1-5-31-43(32-6-2)39-27-23-37(24-28-39)42(38-25-29-40(30-26-38)44(33-7-3)34-8-4)22-16-15-21-41(35-17-11-9-12-18-35)36-19-13-10-14-20-36/h9-30H,5-8,31-34H2,1-4H3 |
| InChIKey | CFZNPXHUDNDADZ-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.88 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|