C26H42O5 — CID 59990015
(1S,6S)-6-[2-(4-butoxybutyl)-4-hydroxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid (PubChem CID 59990015) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is (1S,6S)-6-[2-(4-butoxybutyl)-4-hydroxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[2-(4-butoxybutyl)-4-hydroxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59990015 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (1S,6S)-6-[2-(4-butoxybutyl)-4-hydroxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
| SMILES | CCCCOCCCCC1C(C)C(O)CC1[C@@]1(C=O)CC2C=C(C(C)C)[C@@]1(C(=O)O)C2 |
| InChI | InChI=1S/C26H42O5/c1-5-6-10-31-11-8-7-9-20-18(4)23(28)13-22(20)25(16-27)14-19-12-21(17(2)3)26(25,15-19)24(29)30/h12,16-20,22-23,28H,5-11,13-15H2,1-4H3,(H,29,30)/t18?,19?,20?,22?,23?,25-,26+/m0/s1 |
| InChIKey | SYTIIISGARBOPY-MZUVOEBPSA-N |
| XLogP | 4.87 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|