C24H38O5 — CID 59990028
(1S,6S)-6-formyl-6-[4-methoxy-2-(4-methoxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid (PubChem CID 59990028) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is (1S,6S)-6-formyl-6-[4-methoxy-2-(4-methoxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-formyl-6-[4-methoxy-2-(4-methoxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59990028 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (1S,6S)-6-formyl-6-[4-methoxy-2-(4-methoxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
| SMILES | COCCCCC1C(C)C(OC)CC1[C@@]1(C=O)CC2C=C(C(C)C)[C@@]1(C(=O)O)C2 |
| InChI | InChI=1S/C24H38O5/c1-15(2)19-10-17-12-23(14-25,24(19,13-17)22(26)27)20-11-21(29-5)16(3)18(20)8-6-7-9-28-4/h10,14-18,20-21H,6-9,11-13H2,1-5H3,(H,26,27)/t16?,17?,18?,20?,21?,23-,24+/m0/s1 |
| InChIKey | LKHLBRZJKKGYFH-GWQUYOOKSA-N |
| XLogP | 4.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|