C27H44O5 — CID 59990045
(1S,6S)-6-[2-(4-butoxybutyl)-4-methoxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid (PubChem CID 59990045) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is (1S,6S)-6-[2-(4-butoxybutyl)-4-methoxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[2-(4-butoxybutyl)-4-methoxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59990045 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (1S,6S)-6-[2-(4-butoxybutyl)-4-methoxy-3-methylcyclopentyl]-6-formyl-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
| SMILES | CCCCOCCCCC1C(C)C(OC)CC1[C@@]1(C=O)CC2C=C(C(C)C)[C@@]1(C(=O)O)C2 |
| InChI | InChI=1S/C27H44O5/c1-6-7-11-32-12-9-8-10-21-19(4)24(31-5)14-23(21)26(17-28)15-20-13-22(18(2)3)27(26,16-20)25(29)30/h13,17-21,23-24H,6-12,14-16H2,1-5H3,(H,29,30)/t19?,20?,21?,23?,24?,26-,27+/m0/s1 |
| InChIKey | MSKUQSYTECTJKF-HZNIJUQOSA-N |
| XLogP | 5.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|