C22H34O5 — CID 59990049
(1S,6S)-6-formyl-6-[4-hydroxy-2-(4-hydroxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid (PubChem CID 59990049) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (1S,6S)-6-formyl-6-[4-hydroxy-2-(4-hydroxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-formyl-6-[4-hydroxy-2-(4-hydroxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59990049 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1S,6S)-6-formyl-6-[4-hydroxy-2-(4-hydroxybutyl)-3-methylcyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
| SMILES | CC(C)C1=CC2C[C@@]1(C(=O)O)[C@@](C=O)(C1CC(O)C(C)C1CCCCO)C2 |
| InChI | InChI=1S/C22H34O5/c1-13(2)17-8-15-10-21(12-24,22(17,11-15)20(26)27)18-9-19(25)14(3)16(18)6-4-5-7-23/h8,12-16,18-19,23,25H,4-7,9-11H2,1-3H3,(H,26,27)/t14?,15?,16?,18?,19?,21-,22+/m0/s1 |
| InChIKey | WHMLYRCUGFWFRN-UOIQRYNFSA-N |
| XLogP | 3.04 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|