C28H46O5 — CID 59990063
(1S,6S)-6-formyl-6-[3-methyl-4-propoxy-2-(4-propoxybutyl)cyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid (PubChem CID 59990063) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is (1S,6S)-6-formyl-6-[3-methyl-4-propoxy-2-(4-propoxybutyl)cyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-formyl-6-[3-methyl-4-propoxy-2-(4-propoxybutyl)cyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59990063 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (1S,6S)-6-formyl-6-[3-methyl-4-propoxy-2-(4-propoxybutyl)cyclopentyl]-2-propan-2-ylbicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
| SMILES | CCCOCCCCC1C(C)C(OCCC)CC1[C@@]1(C=O)CC2C=C(C(C)C)[C@@]1(C(=O)O)C2 |
| InChI | InChI=1S/C28H46O5/c1-6-11-32-13-9-8-10-22-20(5)25(33-12-7-2)15-24(22)27(18-29)16-21-14-23(19(3)4)28(27,17-21)26(30)31/h14,18-22,24-25H,6-13,15-17H2,1-5H3,(H,30,31)/t20?,21?,22?,24?,25?,27-,28+/m0/s1 |
| InChIKey | BPLBMXZEPLFVGV-HCIBCSRISA-N |
| XLogP | 5.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|