About CID 59990214
CID 59990214 (PubChem CID 59990214) has the molecular formula C24H44NO5S
and a molecular weight of 458.69 g/mol.
Molecular Properties
| Compound Name | CID 59990214 |
| PubChem CID | 59990214 |
| Molecular Formula | C24H44NO5S |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)SC[CH]C(N)=O |
| InChI | InChI=1S/C24H44NO5S/c1-5-9-11-19(7-3)17-29-23(27)15-21(31-14-13-22(25)26)16-24(28)30-18-20(8-4)12-10-6-2/h13,19-21H,5-12,14-18H2,1-4H3,(H2,25,26) |
| InChIKey | DKMWTWKCUZJZSC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 59990214 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59990214?
The IUPAC name of CID 59990214 (CID 59990214) is not available.
What is the SMILES notation for CID 59990214?
The canonical SMILES for CID 59990214 is CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)SC[CH]C(N)=O.
What is the InChIKey of CID 59990214?
The InChIKey is DKMWTWKCUZJZSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44NO5S/c1-5-9-11-19(7-3)17-29-23(27)15-21(31-14-13-22(25)26)16-24(28)30-18-20(8-4)12-10-6-2/h13,19-21H,5-12,14-18H2,1-4H3,(H2,25,26).
What are the key properties of CID 59990214?
CID 59990214 has a molecular weight of 458.69 g/mol, XLogP of 5.08, 20 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59990214 is sourced from PubChem (CID 59990214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).