About CID 59990220
CID 59990220 (PubChem CID 59990220) has the molecular formula C24H45O4S
and a molecular weight of 429.69 g/mol.
Molecular Properties
| Compound Name | CID 59990220 |
| PubChem CID | 59990220 |
| Molecular Formula | C24H45O4S |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | — |
| SMILES | C[CH]CSC(CC(=O)OCC(CC)CCCC)CC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C24H45O4S/c1-6-11-13-20(9-4)18-27-23(25)16-22(29-15-8-3)17-24(26)28-19-21(10-5)14-12-7-2/h8,20-22H,6-7,9-19H2,1-5H3 |
| InChIKey | SXGDDSYSGQQXHS-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 59990220 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59990220?
The IUPAC name of CID 59990220 (CID 59990220) is not available.
What is the SMILES notation for CID 59990220?
The canonical SMILES for CID 59990220 is C[CH]CSC(CC(=O)OCC(CC)CCCC)CC(=O)OCC(CC)CCCC.
What is the InChIKey of CID 59990220?
The InChIKey is SXGDDSYSGQQXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H45O4S/c1-6-11-13-20(9-4)18-27-23(25)16-22(29-15-8-3)17-24(26)28-19-21(10-5)14-12-7-2/h8,20-22H,6-7,9-19H2,1-5H3.
What are the key properties of CID 59990220?
CID 59990220 has a molecular weight of 429.69 g/mol, XLogP of 6.61, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59990220 is sourced from PubChem (CID 59990220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).