C20H34O3 — CID 59990323
3-[(E)-2,4,4,6,6,8,8-heptamethylnon-2-enyl]oxolane-2,5-dione (PubChem CID 59990323) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-[(E)-2,4,4,6,6,8,8-heptamethylnon-2-enyl]oxolane-2,5-dione.
| Compound Name | 3-[(E)-2,4,4,6,6,8,8-heptamethylnon-2-enyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 59990323 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 3-[(E)-2,4,4,6,6,8,8-heptamethylnon-2-enyl]oxolane-2,5-dione |
| SMILES | C/C(=C\C(C)(C)CC(C)(C)CC(C)(C)C)CC1CC(=O)OC1=O |
| InChI | InChI=1S/C20H34O3/c1-14(9-15-10-16(21)23-17(15)22)11-19(5,6)13-20(7,8)12-18(2,3)4/h11,15H,9-10,12-13H2,1-8H3/b14-11+ |
| InChIKey | PFQYAFWTWUZOLO-SDNWHVSQSA-N |
| XLogP | 5.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|