About (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene
(Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene (PubChem CID 59990329) has the molecular formula C14H28O2S
and a molecular weight of 260.44 g/mol. Its IUPAC name is (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene.
Molecular Properties
| Compound Name | (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene |
| PubChem CID | 59990329 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene |
| SMILES | CC(C)(C)/C=C\CCCS(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H28O2S/c1-13(2,3)10-8-7-9-11-17(15,16)12-14(4,5)6/h8,10H,7,9,11-12H2,1-6H3/b10-8- |
| InChIKey | QSKRRBJWKYOSNJ-NTMALXAHSA-N |
| XLogP | 3.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene?
The IUPAC name of (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene (CID 59990329) is (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene.
What is the SMILES notation for (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene?
The canonical SMILES for (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene is CC(C)(C)/C=C\CCCS(=O)(=O)CC(C)(C)C.
What is the InChIKey of (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene?
The InChIKey is QSKRRBJWKYOSNJ-NTMALXAHSA-N. The full InChI is InChI=1S/C14H28O2S/c1-13(2,3)10-8-7-9-11-17(15,16)12-14(4,5)6/h8,10H,7,9,11-12H2,1-6H3/b10-8-.
What are the key properties of (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene?
(Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene has a molecular weight of 260.44 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-(2,2-dimethylpropylsulfonyl)-2,2-dimethylhept-3-ene is sourced from PubChem (CID 59990329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).