C12H17IN2S — CID 59990606
(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-amine (PubChem CID 59990606) has the molecular formula C12H17IN2S and a molecular weight of 348.25 g/mol. Its IUPAC name is (1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-amine.
| Compound Name | (1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 59990606 |
| Molecular Formula | C12H17IN2S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-amine |
| SMILES | C/C(I)=C/C[C@H](N)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C12H17IN2S/c1-8(12(14)5-4-9(2)13)6-11-7-16-10(3)15-11/h4,6-7,12H,5,14H2,1-3H3/b8-6+,9-4-/t12-/m0/s1 |
| InChIKey | OPVAWFUOKLIBMX-ITOCJQPVSA-N |
| XLogP | 3.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|