About (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol
(2S)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 59990743) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| PubChem CID | 59990743 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC[C@H](O)Cn1cncn1 |
| InChI | InChI=1S/C6H11N3O/c1-2-6(10)3-9-5-7-4-8-9/h4-6,10H,2-3H2,1H3/t6-/m0/s1 |
| InChIKey | QQJIRQMOCFESJB-LURJTMIESA-N |
| XLogP | 0.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol?
The IUPAC name of (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol (CID 59990743) is (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol.
What is the SMILES notation for (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol?
The canonical SMILES for (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol is CC[C@H](O)Cn1cncn1.
What is the InChIKey of (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol?
The InChIKey is QQJIRQMOCFESJB-LURJTMIESA-N. The full InChI is InChI=1S/C6H11N3O/c1-2-6(10)3-9-5-7-4-8-9/h4-6,10H,2-3H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol?
(2S)-1-(1,2,4-triazol-1-yl)butan-2-ol has a molecular weight of 141.17 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(1,2,4-triazol-1-yl)butan-2-ol is sourced from PubChem (CID 59990743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).