C22H30N2O4 — CID 59990871
(1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-N,N-dimethyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 59990871) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-N,N-dimethyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-N,N-dimethyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 59990871 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-N,N-dimethyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | C[C@H]1C=C[C@H]2CCCC[C@@H]2C1C(=O)C1=C[C@]2(O)[C@H](C(=O)N(C)C)CCN2C1=O |
| InChI | InChI=1S/C22H30N2O4/c1-13-8-9-14-6-4-5-7-15(14)18(13)19(25)16-12-22(28)17(21(27)23(2)3)10-11-24(22)20(16)26/h8-9,12-15,17-18,28H,4-7,10-11H2,1-3H3/t13-,14+,15-,17-,18?,22-/m0/s1 |
| InChIKey | KXJWHDKJOPCFAI-GDPMERBASA-N |
| XLogP | 1.75 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|