C22H29NO5 — CID 59990879
methyl (1R,8R)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 59990879) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl (1R,8R)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | methyl (1R,8R)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 59990879 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | methyl (1R,8R)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN2C(=O)C(C(=O)C3[C@H]4CCCC[C@@H]4C=C[C@@H]3C)=C(C)[C@]12O |
| InChI | InChI=1S/C22H29NO5/c1-12-8-9-14-6-4-5-7-15(14)17(12)19(24)18-13(2)22(27)16(21(26)28-3)10-11-23(22)20(18)25/h8-9,12,14-17,27H,4-7,10-11H2,1-3H3/t12-,14+,15-,16-,17?,22-/m0/s1 |
| InChIKey | FPBYLMUPWXFJMH-NEIAKUNASA-N |
| XLogP | 2.22 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|