C23H32N2O4 — CID 59990881
(1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N-propyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 59990881) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N-propyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N-propyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 59990881 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N-propyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CCN2C(=O)C(C(=O)C3[C@H]4CCCC[C@@H]4C=C[C@@H]3C)=C[C@]12O |
| InChI | InChI=1S/C23H32N2O4/c1-3-11-24-21(27)18-10-12-25-22(28)17(13-23(18,25)29)20(26)19-14(2)8-9-15-6-4-5-7-16(15)19/h8-9,13-16,18-19,29H,3-7,10-12H2,1-2H3,(H,24,27)/t14-,15+,16-,18-,19?,23-/m0/s1 |
| InChIKey | DCAHJTYGBQCZMM-MBUCVYHRSA-N |
| XLogP | 2.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|