C25H36N2O4 — CID 59990893
(1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-N-butyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 59990893) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-N-butyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-N-butyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 59990893 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-N-butyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CCCCN(C)C(=O)[C@@H]1CCN2C(=O)C(C(=O)C3[C@H]4CCCC[C@@H]4C=C[C@@H]3C)=C[C@]12O |
| InChI | InChI=1S/C25H36N2O4/c1-4-5-13-26(3)24(30)20-12-14-27-23(29)19(15-25(20,27)31)22(28)21-16(2)10-11-17-8-6-7-9-18(17)21/h10-11,15-18,20-21,31H,4-9,12-14H2,1-3H3/t16-,17+,18-,20-,21?,25-/m0/s1 |
| InChIKey | JFXZJUNSLIYSOW-ZVLMPQBMSA-N |
| XLogP | 2.92 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|