About CID 59991383
CID 59991383 (PubChem CID 59991383) has the molecular formula C44H80NO7Si2
and a molecular weight of 791.30 g/mol.
Molecular Properties
| Compound Name | CID 59991383 |
| PubChem CID | 59991383 |
| Molecular Formula | C44H80NO7Si2 |
| Molecular Weight | 791.30 g/mol |
| Exact Mass | 790.55 |
| IUPAC Name | — |
| SMILES | C=C/C=C\C(C)C(OC(N)=O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C/C(C)=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)/C=C\[CH]CC(=O)CCC(=O)OCC |
| InChI | InChI=1S/C44H80NO7Si2/c1-19-21-24-33(5)40(50-42(45)48)36(8)41(52-54(17,18)44(12,13)14)35(7)30-31(3)29-34(6)39(51-53(15,16)43(9,10)11)32(4)25-22-23-26-37(46)27-28-38(47)49-20-2/h19,21-25,29,32-36,39-41H,1,20,26-28,30H2,2-18H3,(H2,45,48)/b24-21-,25-22-,31-29- |
| InChIKey | QULHWAMEEKBRGB-QBIAQPAFSA-N |
| XLogP | 11.55 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 791.30 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 59991383 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59991383?
The IUPAC name of CID 59991383 (CID 59991383) is not available.
What is the SMILES notation for CID 59991383?
The canonical SMILES for CID 59991383 is C=C/C=C\C(C)C(OC(N)=O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C/C(C)=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)/C=C\[CH]CC(=O)CCC(=O)OCC.
What is the InChIKey of CID 59991383?
The InChIKey is QULHWAMEEKBRGB-QBIAQPAFSA-N. The full InChI is InChI=1S/C44H80NO7Si2/c1-19-21-24-33(5)40(50-42(45)48)36(8)41(52-54(17,18)44(12,13)14)35(7)30-31(3)29-34(6)39(51-53(15,16)43(9,10)11)32(4)25-22-23-26-37(46)27-28-38(47)49-20-2/h19,21-25,29,32-36,39-41H,1,20,26-28,30H2,2-18H3,(H2,45,48)/b24-21-,25-22-,31-29-.
What are the key properties of CID 59991383?
CID 59991383 has a molecular weight of 791.30 g/mol, XLogP of 11.55, 24 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59991383 is sourced from PubChem (CID 59991383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).