C18H33O9PW2-2 — CID 59991686
[(2R,4R,5S)-4-hydroxy-5-methyl-2-(propan-2-yloxymethyl)oxolan-3-yl] [(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methyl phosphate;tungsten (PubChem CID 59991686) has the molecular formula C18H33O9PW2-2 and a molecular weight of 792.11 g/mol. Its IUPAC name is [(2R,4R,5S)-4-hydroxy-5-methyl-2-(propan-2-yloxymethyl)oxolan-3-yl] [(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methyl phosphate;tungsten.
| Compound Name | [(2R,4R,5S)-4-hydroxy-5-methyl-2-(propan-2-yloxymethyl)oxolan-3-yl] [(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methyl phosphate;tungsten |
|---|---|
| PubChem CID | 59991686 |
| Molecular Formula | C18H33O9PW2-2 |
| Molecular Weight | 792.11 g/mol |
| Exact Mass | 792.09 |
| IUPAC Name | [(2R,4R,5S)-4-hydroxy-5-methyl-2-(propan-2-yloxymethyl)oxolan-3-yl] [(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methyl phosphate;tungsten |
| SMILES | CC(C)OC[C@H]1O[C@@H](C)[C@@H](O)C1OP(=O)([O-])O[CH-][C@H]1O[C@@H](C)CC1OC(C)C.[W].[W] |
| InChI | InChI=1S/C18H34O9P.2W/c1-10(2)22-8-16-18(17(19)13(6)26-16)27-28(20,21)23-9-15-14(24-11(3)4)7-12(5)25-15;;/h9-19H,7-8H2,1-6H3,(H,20,21);;/q-1;;/p-1/t12-,13-,14?,15+,16+,17+,18?;;/m0../s1 |
| InChIKey | JUJYGTYCXOAOEE-LFKMBZRJSA-M |
| XLogP | 1.56 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|