About 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one
4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one (PubChem CID 599923) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one |
| PubChem CID | 599923 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C17H23NO2/c1-16(2,3)12-8-10-17(11-9-12)18-15(19)13-6-4-5-7-14(13)20-17/h4-7,12H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | STJVENDQRFTLCO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
The IUPAC name of 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one (CID 599923) is 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one.
What is the SMILES notation for 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
The canonical SMILES for 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one is CC(C)(C)C1CCC2(CC1)NC(=O)c1ccccc1O2.
What is the InChIKey of 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
The InChIKey is STJVENDQRFTLCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2/c1-16(2,3)12-8-10-17(11-9-12)18-15(19)13-6-4-5-7-14(13)20-17/h4-7,12H,8-11H2,1-3H3,(H,18,19).
What are the key properties of 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one has a molecular weight of 273.38 g/mol, XLogP of 3.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-tert-butylspiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 599923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).