C11H20O2 — CID 59993650
(3R,4S)-6-ethyl-3,4,5-trimethyloxane-2-carbaldehyde (PubChem CID 59993650) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (3R,4S)-6-ethyl-3,4,5-trimethyloxane-2-carbaldehyde.
| Compound Name | (3R,4S)-6-ethyl-3,4,5-trimethyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 59993650 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3R,4S)-6-ethyl-3,4,5-trimethyloxane-2-carbaldehyde |
| SMILES | CCC1OC(C=O)[C@H](C)[C@@H](C)C1C |
| InChI | InChI=1S/C11H20O2/c1-5-10-8(3)7(2)9(4)11(6-12)13-10/h6-11H,5H2,1-4H3/t7-,8?,9+,10?,11?/m0/s1 |
| InChIKey | KFKFGXDUCNWYCA-PWSYDOOTSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|