About 3-methoxynaphthalen-2-ol
3-methoxynaphthalen-2-ol (PubChem CID 599943) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-methoxynaphthalen-2-ol.
Molecular Properties
| Compound Name | 3-methoxynaphthalen-2-ol |
| PubChem CID | 599943 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3-methoxynaphthalen-2-ol |
| SMILES | COc1cc2ccccc2cc1O |
| InChI | InChI=1S/C11H10O2/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7,12H,1H3 |
| InChIKey | SJTNTIRIRIPZDV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxynaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxynaphthalen-2-ol?
The IUPAC name of 3-methoxynaphthalen-2-ol (CID 599943) is 3-methoxynaphthalen-2-ol.
What is the SMILES notation for 3-methoxynaphthalen-2-ol?
The canonical SMILES for 3-methoxynaphthalen-2-ol is COc1cc2ccccc2cc1O.
What is the InChIKey of 3-methoxynaphthalen-2-ol?
The InChIKey is SJTNTIRIRIPZDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7,12H,1H3.
What are the key properties of 3-methoxynaphthalen-2-ol?
3-methoxynaphthalen-2-ol has a molecular weight of 174.20 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxynaphthalen-2-ol is sourced from PubChem (CID 599943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).