C15H30O5Si — CID 59994405
methyl (1R,3R,4S,5R)-3-[butyl(dimethyl)silyl]oxy-1,4-dihydroxy-5-methylcyclohexane-1-carboxylate (PubChem CID 59994405) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is methyl (1R,3R,4S,5R)-3-[butyl(dimethyl)silyl]oxy-1,4-dihydroxy-5-methylcyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3R,4S,5R)-3-[butyl(dimethyl)silyl]oxy-1,4-dihydroxy-5-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59994405 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | methyl (1R,3R,4S,5R)-3-[butyl(dimethyl)silyl]oxy-1,4-dihydroxy-5-methylcyclohexane-1-carboxylate |
| SMILES | CCCC[Si](C)(C)O[C@@H]1C[C@@](O)(C(=O)OC)C[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C15H30O5Si/c1-6-7-8-21(4,5)20-12-10-15(18,14(17)19-3)9-11(2)13(12)16/h11-13,16,18H,6-10H2,1-5H3/t11-,12-,13+,15-/m1/s1 |
| InChIKey | LATNXUGOIWHNDU-GUIRCDHDSA-N |
| XLogP | 2.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|