C23H28N2O3 — CID 59994462
methoxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate (PubChem CID 59994462) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is methoxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate.
| Compound Name | methoxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate |
|---|---|
| PubChem CID | 59994462 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | methoxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate |
| SMILES | COCOC(=O)C1=CCCC2CN3CCc4c(n(C)c5ccccc45)C3CC12 |
| InChI | InChI=1S/C23H28N2O3/c1-24-20-9-4-3-7-16(20)17-10-11-25-13-15-6-5-8-18(23(26)28-14-27-2)19(15)12-21(25)22(17)24/h3-4,7-9,15,19,21H,5-6,10-14H2,1-2H3 |
| InChIKey | HITMODIICDHNCC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|