C13H14F2N4O — CID 59995572
6,7-difluoro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one (PubChem CID 59995572) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 6,7-difluoro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one.
| Compound Name | 6,7-difluoro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 59995572 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 6,7-difluoro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one |
| SMILES | CN1CCN(c2nc3cc(F)c(F)cc3[nH]c2=O)CC1 |
| InChI | InChI=1S/C13H14F2N4O/c1-18-2-4-19(5-3-18)12-13(20)17-11-7-9(15)8(14)6-10(11)16-12/h6-7H,2-5H2,1H3,(H,17,20) |
| InChIKey | YMDMWIWULDEQRE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |