About 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine
3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine (PubChem CID 59995659) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine |
| PubChem CID | 59995659 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine |
| SMILES | CCC(CC)n1nc(C)c2ncc(C)nc21 |
| InChI | InChI=1S/C12H18N4/c1-5-10(6-2)16-12-11(9(4)15-16)13-7-8(3)14-12/h7,10H,5-6H2,1-4H3 |
| InChIKey | UOFCIZJNXQPVRA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine?
The IUPAC name of 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine (CID 59995659) is 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine?
The canonical SMILES for 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine is CCC(CC)n1nc(C)c2ncc(C)nc21.
What is the InChIKey of 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine?
The InChIKey is UOFCIZJNXQPVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-5-10(6-2)16-12-11(9(4)15-16)13-7-8(3)14-12/h7,10H,5-6H2,1-4H3.
What are the key properties of 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine?
3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine has a molecular weight of 218.30 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-pentan-3-ylpyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 59995659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).