C19H23F3N5O2+ — CID 59995679
5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethyl-1-pentan-3-yltriazolo[4,5-b]pyrazin-3-ium (PubChem CID 59995679) has the molecular formula C19H23F3N5O2+ and a molecular weight of 410.42 g/mol. Its IUPAC name is 5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethyl-1-pentan-3-yltriazolo[4,5-b]pyrazin-3-ium.
| Compound Name | 5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethyl-1-pentan-3-yltriazolo[4,5-b]pyrazin-3-ium |
|---|---|
| PubChem CID | 59995679 |
| Molecular Formula | C19H23F3N5O2+ |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethyl-1-pentan-3-yltriazolo[4,5-b]pyrazin-3-ium |
| SMILES | CCC(CC)n1n[n+](C)c2nc(-c3ccc(OC(F)(F)F)cc3OC)c(C)nc21 |
| InChI | InChI=1S/C19H23F3N5O2/c1-6-12(7-2)27-18-17(26(4)25-27)24-16(11(3)23-18)14-9-8-13(10-15(14)28-5)29-19(20,21)22/h8-10,12H,6-7H2,1-5H3/q+1 |
| InChIKey | OUAFQOLHEPCYLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|