C19H19FN2O — CID 59995880
2-(5-benzyl-1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone (PubChem CID 59995880) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-(5-benzyl-1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-(5-benzyl-1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 59995880 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-(5-benzyl-1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone |
| SMILES | O=C(C=C1NCC(Cc2ccccc2)CN1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O/c20-17-8-6-16(7-9-17)18(23)11-19-21-12-15(13-22-19)10-14-4-2-1-3-5-14/h1-9,11,15,21-22H,10,12-13H2/b19-11- |
| InChIKey | LSRTZAPFOUVBQC-ODLFYWEKSA-N |
| XLogP | 2.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|