C26H22F3N3O4 — CID 59995912
N-(3-isocyanophenyl)-6,8-dimethoxy-1-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 59995912) has the molecular formula C26H22F3N3O4 and a molecular weight of 497.47 g/mol. Its IUPAC name is N-(3-isocyanophenyl)-6,8-dimethoxy-1-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-(3-isocyanophenyl)-6,8-dimethoxy-1-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 59995912 |
| Molecular Formula | C26H22F3N3O4 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-(3-isocyanophenyl)-6,8-dimethoxy-1-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | [C-]#[N+]c1cccc(NC(=O)N2CCc3cc(OC)cc(OC)c3C2c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H22F3N3O4/c1-30-18-7-5-8-19(14-18)31-25(33)32-11-10-16-12-21(34-2)15-22(35-3)23(16)24(32)17-6-4-9-20(13-17)36-26(27,28)29/h4-9,12-15,24H,10-11H2,2-3H3,(H,31,33) |
| InChIKey | LSFTZXCYMZBOFE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|