About (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one
(5Z)-5-ethylidene-2,3-dimethylimidazol-4-one (PubChem CID 59996536) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one.
Molecular Properties
| Compound Name | (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one |
| PubChem CID | 59996536 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one |
| SMILES | C/C=C1\N=C(C)N(C)C1=O |
| InChI | InChI=1S/C7H10N2O/c1-4-6-7(10)9(3)5(2)8-6/h4H,1-3H3/b6-4- |
| InChIKey | COIAEJLNKLBMSU-XQRVVYSFSA-N |
| XLogP | 0.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one?
The IUPAC name of (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one (CID 59996536) is (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one.
What is the SMILES notation for (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one?
The canonical SMILES for (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one is C/C=C1\N=C(C)N(C)C1=O.
What is the InChIKey of (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one?
The InChIKey is COIAEJLNKLBMSU-XQRVVYSFSA-N. The full InChI is InChI=1S/C7H10N2O/c1-4-6-7(10)9(3)5(2)8-6/h4H,1-3H3/b6-4-.
What are the key properties of (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one?
(5Z)-5-ethylidene-2,3-dimethylimidazol-4-one has a molecular weight of 138.17 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-ethylidene-2,3-dimethylimidazol-4-one is sourced from PubChem (CID 59996536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).