C28H38N4O5S — CID 59996608
[(1S,2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 7-methylsulfanyl-4-oxo-1H-pyrimido[4,5-c]pyridazine-3-carboxylate (PubChem CID 59996608) has the molecular formula C28H38N4O5S and a molecular weight of 542.70 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 7-methylsulfanyl-4-oxo-1H-pyrimido[4,5-c]pyridazine-3-carboxylate.
| Compound Name | [(1S,2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 7-methylsulfanyl-4-oxo-1H-pyrimido[4,5-c]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 59996608 |
| Molecular Formula | C28H38N4O5S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 7-methylsulfanyl-4-oxo-1H-pyrimido[4,5-c]pyridazine-3-carboxylate |
| SMILES | CC[C@]1(C)C[C@@H](OC(=O)c2n[nH]c3nc(SC)ncc3c2=O)[C@]2(C)C(C)CC[C@]3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H38N4O5S/c1-7-26(4)12-18(37-24(36)19-20(34)16-13-29-25(38-6)30-23(16)32-31-19)27(5)14(2)8-10-28(15(3)22(26)35)11-9-17(33)21(27)28/h13-15,18,21-22,35H,7-12H2,1-6H3,(H,29,30,32,34)/t14?,15-,18+,21?,22-,26+,27-,28-/m0/s1 |
| InChIKey | WKLSZUJXZOPPPU-CPCSPEOCSA-N |
| XLogP | 4.18 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |