C17H33NO — CID 59996889
5,6-ditert-butyl-1-propylazepan-2-one (PubChem CID 59996889) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-propylazepan-2-one.
| Compound Name | 5,6-ditert-butyl-1-propylazepan-2-one |
|---|---|
| PubChem CID | 59996889 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 5,6-ditert-butyl-1-propylazepan-2-one |
| SMILES | CCCN1CC(C(C)(C)C)C(C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C17H33NO/c1-8-11-18-12-14(17(5,6)7)13(16(2,3)4)9-10-15(18)19/h13-14H,8-12H2,1-7H3 |
| InChIKey | DLPKRGRCHPKLAF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |