C16H30N2O — CID 59996896
1,7-ditert-butyl-3,4,4a,6,8,8a-hexahydro-2H-1,7-naphthyridin-5-one (PubChem CID 59996896) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1,7-ditert-butyl-3,4,4a,6,8,8a-hexahydro-2H-1,7-naphthyridin-5-one.
| Compound Name | 1,7-ditert-butyl-3,4,4a,6,8,8a-hexahydro-2H-1,7-naphthyridin-5-one |
|---|---|
| PubChem CID | 59996896 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1,7-ditert-butyl-3,4,4a,6,8,8a-hexahydro-2H-1,7-naphthyridin-5-one |
| SMILES | CC(C)(C)N1CC(=O)C2CCCN(C(C)(C)C)C2C1 |
| InChI | InChI=1S/C16H30N2O/c1-15(2,3)17-10-13-12(14(19)11-17)8-7-9-18(13)16(4,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | MLDLYLYRAHLOSF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |