C17H29NO3 — CID 59996915
5,6-ditert-butyl-1-propylazepane-2,4,7-trione (PubChem CID 59996915) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-propylazepane-2,4,7-trione.
| Compound Name | 5,6-ditert-butyl-1-propylazepane-2,4,7-trione |
|---|---|
| PubChem CID | 59996915 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 5,6-ditert-butyl-1-propylazepane-2,4,7-trione |
| SMILES | CCCN1C(=O)CC(=O)C(C(C)(C)C)C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H29NO3/c1-8-9-18-12(20)10-11(19)13(16(2,3)4)14(15(18)21)17(5,6)7/h13-14H,8-10H2,1-7H3 |
| InChIKey | JJEOUHUFTANGTO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|