About 5,6-ditert-butyl-3-propyl-1,3-oxazinane
5,6-ditert-butyl-3-propyl-1,3-oxazinane (PubChem CID 59996916) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 5,6-ditert-butyl-3-propyl-1,3-oxazinane.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-3-propyl-1,3-oxazinane |
| PubChem CID | 59996916 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 5,6-ditert-butyl-3-propyl-1,3-oxazinane |
| SMILES | CCCN1COC(C(C)(C)C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H31NO/c1-8-9-16-10-12(14(2,3)4)13(17-11-16)15(5,6)7/h12-13H,8-11H2,1-7H3 |
| InChIKey | OENVNRPGIFYTML-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-ditert-butyl-3-propyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-3-propyl-1,3-oxazinane?
The IUPAC name of 5,6-ditert-butyl-3-propyl-1,3-oxazinane (CID 59996916) is 5,6-ditert-butyl-3-propyl-1,3-oxazinane.
What is the SMILES notation for 5,6-ditert-butyl-3-propyl-1,3-oxazinane?
The canonical SMILES for 5,6-ditert-butyl-3-propyl-1,3-oxazinane is CCCN1COC(C(C)(C)C)C(C(C)(C)C)C1.
What is the InChIKey of 5,6-ditert-butyl-3-propyl-1,3-oxazinane?
The InChIKey is OENVNRPGIFYTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-8-9-16-10-12(14(2,3)4)13(17-11-16)15(5,6)7/h12-13H,8-11H2,1-7H3.
What are the key properties of 5,6-ditert-butyl-3-propyl-1,3-oxazinane?
5,6-ditert-butyl-3-propyl-1,3-oxazinane has a molecular weight of 241.42 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-3-propyl-1,3-oxazinane is sourced from PubChem (CID 59996916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).