C26H25F6N5O2 — CID 59997008
N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 59997008) has the molecular formula C26H25F6N5O2 and a molecular weight of 553.51 g/mol. Its IUPAC name is N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59997008 |
| Molecular Formula | C26H25F6N5O2 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(OC[C@@H]2CCCN2)(C(F)(F)F)C(F)(F)F)cc1)c1cccnc1NCc1ccncc1 |
| InChI | InChI=1S/C26H25F6N5O2/c27-25(28,29)24(26(30,31)32,39-16-20-3-1-11-34-20)18-5-7-19(8-6-18)37-23(38)21-4-2-12-35-22(21)36-15-17-9-13-33-14-10-17/h2,4-10,12-14,20,34H,1,3,11,15-16H2,(H,35,36)(H,37,38)/t20-/m0/s1 |
| InChIKey | VFWSUKJFMJJWCC-FQEVSTJZSA-N |
| XLogP | 5.43 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |