C35H58N2O5Si — CID 59997306
tert-butyl N-[(2S,3R)-4-[[5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentyl]amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate (PubChem CID 59997306) has the molecular formula C35H58N2O5Si and a molecular weight of 614.94 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-[[5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentyl]amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-[[5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentyl]amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59997306 |
| Molecular Formula | C35H58N2O5Si |
| Molecular Weight | 614.94 g/mol |
| Exact Mass | 614.41 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-[[5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentyl]amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(CCCO[Si](C)(C)C(C)(C)C)CNC[C@@H](O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H58N2O5Si/c1-33(2,3)42-32(39)37-30(23-27-17-19-29(20-18-27)40-25-28-15-12-11-13-16-28)31(38)24-36-26-35(7,8)21-14-22-41-43(9,10)34(4,5)6/h11-13,15-20,30-31,36,38H,14,21-26H2,1-10H3,(H,37,39)/t30-,31+/m0/s1 |
| InChIKey | PIOGSJYXDMPPCA-IOWSJCHKSA-N |
| XLogP | 7.48 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.94 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|