About methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+)
methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) (PubChem CID 59997496) has the molecular formula C5H12N3Ru
and a molecular weight of 215.24 g/mol. Its IUPAC name is methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+).
Molecular Properties
| Compound Name | methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) |
| PubChem CID | 59997496 |
| Molecular Formula | C5H12N3Ru |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) |
| SMILES | C/N=C(\[N-]C)N(C)C.[Ru+] |
| InChI | InChI=1S/C5H12N3.Ru/c1-6-5(7-2)8(3)4;/h1-4H3;/q-1;+1 |
| InChIKey | LKCPCGCFSBCNOM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+)?
The IUPAC name of methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) (CID 59997496) is methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+).
What is the SMILES notation for methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+)?
The canonical SMILES for methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) is C/N=C(\[N-]C)N(C)C.[Ru+].
What is the InChIKey of methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+)?
The InChIKey is LKCPCGCFSBCNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N3.Ru/c1-6-5(7-2)8(3)4;/h1-4H3;/q-1;+1.
What are the key properties of methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+)?
methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) has a molecular weight of 215.24 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;ruthenium(1+) is sourced from PubChem (CID 59997496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).