About 2-azanidylethylazanide;carbanide;chloroplatinum
2-azanidylethylazanide;carbanide;chloroplatinum (PubChem CID 59998575) has the molecular formula C3H9ClN2Pt-3
and a molecular weight of 303.65 g/mol. Its IUPAC name is 2-azanidylethylazanide;carbanide;chloroplatinum.
Molecular Properties
| Compound Name | 2-azanidylethylazanide;carbanide;chloroplatinum |
| PubChem CID | 59998575 |
| Molecular Formula | C3H9ClN2Pt-3 |
| Molecular Weight | 303.65 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-azanidylethylazanide;carbanide;chloroplatinum |
| SMILES | Cl[Pt].[CH3-].[NH-]CC[NH-] |
| InChI | InChI=1S/C2H6N2.CH3.ClH.Pt/c3-1-2-4;;;/h3-4H,1-2H2;1H3;1H;/q-2;-1;;+1/p-1 |
| InChIKey | HTCIHTASDSJDIK-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-azanidylethylazanide;carbanide;chloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azanidylethylazanide;carbanide;chloroplatinum?
The IUPAC name of 2-azanidylethylazanide;carbanide;chloroplatinum (CID 59998575) is 2-azanidylethylazanide;carbanide;chloroplatinum.
What is the SMILES notation for 2-azanidylethylazanide;carbanide;chloroplatinum?
The canonical SMILES for 2-azanidylethylazanide;carbanide;chloroplatinum is Cl[Pt].[CH3-].[NH-]CC[NH-].
What is the InChIKey of 2-azanidylethylazanide;carbanide;chloroplatinum?
The InChIKey is HTCIHTASDSJDIK-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H6N2.CH3.ClH.Pt/c3-1-2-4;;;/h3-4H,1-2H2;1H3;1H;/q-2;-1;;+1/p-1.
What are the key properties of 2-azanidylethylazanide;carbanide;chloroplatinum?
2-azanidylethylazanide;carbanide;chloroplatinum has a molecular weight of 303.65 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azanidylethylazanide;carbanide;chloroplatinum is sourced from PubChem (CID 59998575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).