About (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide
(5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide (PubChem CID 59998590) has the molecular formula C4H3F3N3O2S2-
and a molecular weight of 246.22 g/mol. Its IUPAC name is (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide.
Molecular Properties
| Compound Name | (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide |
| PubChem CID | 59998590 |
| Molecular Formula | C4H3F3N3O2S2- |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide |
| SMILES | Cc1nnc([N-]S(=O)(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C4H3F3N3O2S2/c1-2-8-9-3(13-2)10-14(11,12)4(5,6)7/h1H3/q-1 |
| InChIKey | UHIJBHNGQHBYFT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide?
The IUPAC name of (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide (CID 59998590) is (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide?
The canonical SMILES for (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide is Cc1nnc([N-]S(=O)(=O)C(F)(F)F)s1.
What is the InChIKey of (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide?
The InChIKey is UHIJBHNGQHBYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F3N3O2S2/c1-2-8-9-3(13-2)10-14(11,12)4(5,6)7/h1H3/q-1.
What are the key properties of (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide?
(5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide has a molecular weight of 246.22 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3,4-thiadiazol-2-yl)-(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 59998590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).