C50H42N8S4+2 — CID 59998647
3,5-bis[[(4Z)-4-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1-phenyl-4a,8a-dihydroquinolin-2-yl]sulfanyl]-1,2,4-triazol-4-amine (PubChem CID 59998647) has the molecular formula C50H42N8S4+2 and a molecular weight of 883.21 g/mol. Its IUPAC name is 3,5-bis[[(4Z)-4-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1-phenyl-4a,8a-dihydroquinolin-2-yl]sulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis[[(4Z)-4-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1-phenyl-4a,8a-dihydroquinolin-2-yl]sulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 59998647 |
| Molecular Formula | C50H42N8S4+2 |
| Molecular Weight | 883.21 g/mol |
| Exact Mass | 882.24 |
| IUPAC Name | 3,5-bis[[(4Z)-4-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1-phenyl-4a,8a-dihydroquinolin-2-yl]sulfanyl]-1,2,4-triazol-4-amine |
| SMILES | C[n+]1c(/C=C2\C=C(Sc3nnc(SC4=C/C(=C\c5sc6ccccc6[n+]5C)C5C=CC=CC5N4c4ccccc4)n3N)N(c3ccccc3)C3C=CC=CC23)sc2ccccc21 |
| InChI | InChI=1S/C50H42N8S4/c1-54-41-25-13-15-27-43(41)59-45(54)29-33-31-47(56(35-17-5-3-6-18-35)39-23-11-9-21-37(33)39)61-49-52-53-50(58(49)51)62-48-32-34(30-46-55(2)42-26-14-16-28-44(42)60-46)38-22-10-12-24-40(38)57(48)36-19-7-4-8-20-36/h3-32,37-40H,51H2,1-2H3/q+2 |
| InChIKey | ZIHATLWUZGLYEJ-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.21 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|