C29H38N4O3 — CID 59999102
N-[(1S)-3-[2-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-1-phenylpropyl]cyclopentanecarboxamide (PubChem CID 59999102) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[(1S)-3-[2-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-1-phenylpropyl]cyclopentanecarboxamide.
| Compound Name | N-[(1S)-3-[2-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-1-phenylpropyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 59999102 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-[(1S)-3-[2-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-1-phenylpropyl]cyclopentanecarboxamide |
| SMILES | O=C(N[C@@H](CCN1CCC2(CC1)CCN(Cc1cc[n+]([O-])cc1)C2=O)c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C29H38N4O3/c34-27(25-8-4-5-9-25)30-26(24-6-2-1-3-7-24)12-16-31-19-13-29(14-20-31)15-21-32(28(29)35)22-23-10-17-33(36)18-11-23/h1-3,6-7,10-11,17-18,25-26H,4-5,8-9,12-16,19-22H2,(H,30,34)/t26-/m0/s1 |
| InChIKey | VKOOZAZEUQQTMM-SANMLTNESA-N |
| XLogP | 3.57 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|